C10H18N4 — CID 170275343
5-methyl-10,11,12-triazatricyclo[7.3.0.04,6]dodec-1(9)-en-10-amine (PubChem CID 170275343) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 5-methyl-10,11,12-triazatricyclo[7.3.0.04,6]dodec-1(9)-en-10-amine.
| Compound Name | 5-methyl-10,11,12-triazatricyclo[7.3.0.04,6]dodec-1(9)-en-10-amine |
|---|---|
| PubChem CID | 170275343 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 5-methyl-10,11,12-triazatricyclo[7.3.0.04,6]dodec-1(9)-en-10-amine |
| SMILES | CC1C2CCC3=C(CCC12)N(N)NN3 |
| InChI | InChI=1S/C10H18N4/c1-6-7-2-4-9-10(5-3-8(6)7)14(11)13-12-9/h6-8,12-13H,2-5,11H2,1H3 |
| InChIKey | SJYHSBAPBVRHKG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|