C34H18O8S2 — CID 170276108
(21-sulfooxy-12-nonacyclo[18.10.2.22,5.03,16.04,13.06,11.017,31.022,27.028,32]tetratriaconta-1,3(16),4,6,8,10,12,14,17(31),18,20,22,24,26,28(32),29,33-heptadecaenyl) hydrogen sulfate (PubChem CID 170276108) has the molecular formula C34H18O8S2 and a molecular weight of 618.64 g/mol. Its IUPAC name is (21-sulfooxy-12-nonacyclo[18.10.2.22,5.03,16.04,13.06,11.017,31.022,27.028,32]tetratriaconta-1,3(16),4,6,8,10,12,14,17(31),18,20,22,24,26,28(32),29,33-heptadecaenyl) hydrogen sulfate.
| Compound Name | (21-sulfooxy-12-nonacyclo[18.10.2.22,5.03,16.04,13.06,11.017,31.022,27.028,32]tetratriaconta-1,3(16),4,6,8,10,12,14,17(31),18,20,22,24,26,28(32),29,33-heptadecaenyl) hydrogen sulfate |
|---|---|
| PubChem CID | 170276108 |
| Molecular Formula | C34H18O8S2 |
| Molecular Weight | 618.64 g/mol |
| Exact Mass | 618.04 |
| IUPAC Name | (21-sulfooxy-12-nonacyclo[18.10.2.22,5.03,16.04,13.06,11.017,31.022,27.028,32]tetratriaconta-1,3(16),4,6,8,10,12,14,17(31),18,20,22,24,26,28(32),29,33-heptadecaenyl) hydrogen sulfate |
| SMILES | O=S(=O)(O)Oc1c2ccccc2c2ccc3c4ccc5c6ccccc6c(OS(=O)(=O)O)c6ccc(c7ccc1c2c73)c4c65 |
| InChI | InChI=1S/C34H18O8S2/c35-43(36,37)41-33-25-7-3-1-5-17(25)19-9-11-21-22-12-10-20-18-6-2-4-8-26(18)34(42-44(38,39)40)28-16-14-24(30(22)32(20)28)23-13-15-27(33)31(19)29(21)23/h1-16H,(H,35,36,37)(H,38,39,40) |
| InChIKey | ZOAMYSXNOODYKS-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.64 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|