C7H13N3 — CID 170278293
2-methyl-2,3,4,5,6,7-hexahydro-1H-imidazo[4,5-c]pyridine (PubChem CID 170278293) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is 2-methyl-2,3,4,5,6,7-hexahydro-1H-imidazo[4,5-c]pyridine.
| Compound Name | 2-methyl-2,3,4,5,6,7-hexahydro-1H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 170278293 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 2-methyl-2,3,4,5,6,7-hexahydro-1H-imidazo[4,5-c]pyridine |
| SMILES | CC1NC2=C(CNCC2)N1 |
| InChI | InChI=1S/C7H13N3/c1-5-9-6-2-3-8-4-7(6)10-5/h5,8-10H,2-4H2,1H3 |
| InChIKey | UYNPQOVGEWDQCQ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |