About 6-phenoxyisoquinoline
6-phenoxyisoquinoline (PubChem CID 170278308) has the molecular formula C15H11NO
and a molecular weight of 221.26 g/mol. Its IUPAC name is 6-phenoxyisoquinoline.
Molecular Properties
| Compound Name | 6-phenoxyisoquinoline |
| PubChem CID | 170278308 |
| Molecular Formula | C15H11NO |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 6-phenoxyisoquinoline |
| SMILES | c1ccc(Oc2ccc3cnccc3c2)cc1 |
| InChI | InChI=1S/C15H11NO/c1-2-4-14(5-3-1)17-15-7-6-13-11-16-9-8-12(13)10-15/h1-11H |
| InChIKey | NEBNRKWEAYNFCO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-phenoxyisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenoxyisoquinoline?
The IUPAC name of 6-phenoxyisoquinoline (CID 170278308) is 6-phenoxyisoquinoline.
What is the SMILES notation for 6-phenoxyisoquinoline?
The canonical SMILES for 6-phenoxyisoquinoline is c1ccc(Oc2ccc3cnccc3c2)cc1.
What is the InChIKey of 6-phenoxyisoquinoline?
The InChIKey is NEBNRKWEAYNFCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO/c1-2-4-14(5-3-1)17-15-7-6-13-11-16-9-8-12(13)10-15/h1-11H.
What are the key properties of 6-phenoxyisoquinoline?
6-phenoxyisoquinoline has a molecular weight of 221.26 g/mol, XLogP of 4.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenoxyisoquinoline is sourced from PubChem (CID 170278308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).