C13H23N3P2 — CID 170278330
[1-phosphanyl-3-(5-propyl-4,5,6,7-tetrahydrobenzotriazol-1-yl)cyclobutyl]phosphane (PubChem CID 170278330) has the molecular formula C13H23N3P2 and a molecular weight of 283.30 g/mol. Its IUPAC name is [1-phosphanyl-3-(5-propyl-4,5,6,7-tetrahydrobenzotriazol-1-yl)cyclobutyl]phosphane.
| Compound Name | [1-phosphanyl-3-(5-propyl-4,5,6,7-tetrahydrobenzotriazol-1-yl)cyclobutyl]phosphane |
|---|---|
| PubChem CID | 170278330 |
| Molecular Formula | C13H23N3P2 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | [1-phosphanyl-3-(5-propyl-4,5,6,7-tetrahydrobenzotriazol-1-yl)cyclobutyl]phosphane |
| SMILES | CCCC1CCc2c(nnn2C2CC(P)(P)C2)C1 |
| InChI | InChI=1S/C13H23N3P2/c1-2-3-9-4-5-12-11(6-9)14-15-16(12)10-7-13(17,18)8-10/h9-10H,2-8,17-18H2,1H3 |
| InChIKey | MLQFHQQVZXERGL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|