About N-(5-cyclopropyl-2,4-dimethylphenyl)-N-methylmethanesulfinamide
N-(5-cyclopropyl-2,4-dimethylphenyl)-N-methylmethanesulfinamide (PubChem CID 170278641) has the molecular formula C13H19NOS
and a molecular weight of 237.37 g/mol. Its IUPAC name is N-(5-cyclopropyl-2,4-dimethylphenyl)-N-methylmethanesulfinamide.
Molecular Properties
| Compound Name | N-(5-cyclopropyl-2,4-dimethylphenyl)-N-methylmethanesulfinamide |
| PubChem CID | 170278641 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | N-(5-cyclopropyl-2,4-dimethylphenyl)-N-methylmethanesulfinamide |
| SMILES | Cc1cc(C)c(N(C)S(C)=O)cc1C1CC1 |
| InChI | InChI=1S/C13H19NOS/c1-9-7-10(2)13(14(3)16(4)15)8-12(9)11-5-6-11/h7-8,11H,5-6H2,1-4H3 |
| InChIKey | NDAONTPMDUGZMV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(5-cyclopropyl-2,4-dimethylphenyl)-N-methylmethanesulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-cyclopropyl-2,4-dimethylphenyl)-N-methylmethanesulfinamide?
The IUPAC name of N-(5-cyclopropyl-2,4-dimethylphenyl)-N-methylmethanesulfinamide (CID 170278641) is N-(5-cyclopropyl-2,4-dimethylphenyl)-N-methylmethanesulfinamide.
What is the SMILES notation for N-(5-cyclopropyl-2,4-dimethylphenyl)-N-methylmethanesulfinamide?
The canonical SMILES for N-(5-cyclopropyl-2,4-dimethylphenyl)-N-methylmethanesulfinamide is Cc1cc(C)c(N(C)S(C)=O)cc1C1CC1.
What is the InChIKey of N-(5-cyclopropyl-2,4-dimethylphenyl)-N-methylmethanesulfinamide?
The InChIKey is NDAONTPMDUGZMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NOS/c1-9-7-10(2)13(14(3)16(4)15)8-12(9)11-5-6-11/h7-8,11H,5-6H2,1-4H3.
What are the key properties of N-(5-cyclopropyl-2,4-dimethylphenyl)-N-methylmethanesulfinamide?
N-(5-cyclopropyl-2,4-dimethylphenyl)-N-methylmethanesulfinamide has a molecular weight of 237.37 g/mol, XLogP of 2.91, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-cyclopropyl-2,4-dimethylphenyl)-N-methylmethanesulfinamide is sourced from PubChem (CID 170278641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).