About 6-ethenyl-5-[(3Z)-2-methylhexa-3,5-dien-3-yl]-2,3-dihydropyridine
6-ethenyl-5-[(3Z)-2-methylhexa-3,5-dien-3-yl]-2,3-dihydropyridine (PubChem CID 170278859) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is 6-ethenyl-5-[(3Z)-2-methylhexa-3,5-dien-3-yl]-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 6-ethenyl-5-[(3Z)-2-methylhexa-3,5-dien-3-yl]-2,3-dihydropyridine |
| PubChem CID | 170278859 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 6-ethenyl-5-[(3Z)-2-methylhexa-3,5-dien-3-yl]-2,3-dihydropyridine |
| SMILES | C=C/C=C(\C1=CCCN=C1C=C)C(C)C |
| InChI | InChI=1S/C14H19N/c1-5-8-12(11(3)4)13-9-7-10-15-14(13)6-2/h5-6,8-9,11H,1-2,7,10H2,3-4H3/b12-8- |
| InChIKey | AIKCEMKUWABXSA-WQLSENKSSA-N |
| XLogP | 3.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6-ethenyl-5-[(3Z)-2-methylhexa-3,5-dien-3-yl]-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenyl-5-[(3Z)-2-methylhexa-3,5-dien-3-yl]-2,3-dihydropyridine?
The IUPAC name of 6-ethenyl-5-[(3Z)-2-methylhexa-3,5-dien-3-yl]-2,3-dihydropyridine (CID 170278859) is 6-ethenyl-5-[(3Z)-2-methylhexa-3,5-dien-3-yl]-2,3-dihydropyridine.
What is the SMILES notation for 6-ethenyl-5-[(3Z)-2-methylhexa-3,5-dien-3-yl]-2,3-dihydropyridine?
The canonical SMILES for 6-ethenyl-5-[(3Z)-2-methylhexa-3,5-dien-3-yl]-2,3-dihydropyridine is C=C/C=C(\C1=CCCN=C1C=C)C(C)C.
What is the InChIKey of 6-ethenyl-5-[(3Z)-2-methylhexa-3,5-dien-3-yl]-2,3-dihydropyridine?
The InChIKey is AIKCEMKUWABXSA-WQLSENKSSA-N. The full InChI is InChI=1S/C14H19N/c1-5-8-12(11(3)4)13-9-7-10-15-14(13)6-2/h5-6,8-9,11H,1-2,7,10H2,3-4H3/b12-8-.
What are the key properties of 6-ethenyl-5-[(3Z)-2-methylhexa-3,5-dien-3-yl]-2,3-dihydropyridine?
6-ethenyl-5-[(3Z)-2-methylhexa-3,5-dien-3-yl]-2,3-dihydropyridine has a molecular weight of 201.31 g/mol, XLogP of 3.71, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenyl-5-[(3Z)-2-methylhexa-3,5-dien-3-yl]-2,3-dihydropyridine is sourced from PubChem (CID 170278859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).