About 4-[(2,6-difluorophenyl)diazenyl]-5-methyl-1H-pyrazol-3-amine
4-[(2,6-difluorophenyl)diazenyl]-5-methyl-1H-pyrazol-3-amine (PubChem CID 170279040) has the molecular formula C10H9F2N5
and a molecular weight of 237.21 g/mol. Its IUPAC name is 4-[(2,6-difluorophenyl)diazenyl]-5-methyl-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | 4-[(2,6-difluorophenyl)diazenyl]-5-methyl-1H-pyrazol-3-amine |
| PubChem CID | 170279040 |
| Molecular Formula | C10H9F2N5 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 4-[(2,6-difluorophenyl)diazenyl]-5-methyl-1H-pyrazol-3-amine |
| SMILES | Cc1[nH]nc(N)c1/N=N/c1c(F)cccc1F |
| InChI | InChI=1S/C10H9F2N5/c1-5-8(10(13)17-14-5)15-16-9-6(11)3-2-4-7(9)12/h2-4H,1H3,(H3,13,14,17)/b16-15+ |
| InChIKey | GAVBWOIDSHVLAA-FOCLMDBBSA-N |
| XLogP | 2.99 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,6-difluorophenyl)diazenyl]-5-methyl-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,6-difluorophenyl)diazenyl]-5-methyl-1H-pyrazol-3-amine?
The IUPAC name of 4-[(2,6-difluorophenyl)diazenyl]-5-methyl-1H-pyrazol-3-amine (CID 170279040) is 4-[(2,6-difluorophenyl)diazenyl]-5-methyl-1H-pyrazol-3-amine.
What is the SMILES notation for 4-[(2,6-difluorophenyl)diazenyl]-5-methyl-1H-pyrazol-3-amine?
The canonical SMILES for 4-[(2,6-difluorophenyl)diazenyl]-5-methyl-1H-pyrazol-3-amine is Cc1[nH]nc(N)c1/N=N/c1c(F)cccc1F.
What is the InChIKey of 4-[(2,6-difluorophenyl)diazenyl]-5-methyl-1H-pyrazol-3-amine?
The InChIKey is GAVBWOIDSHVLAA-FOCLMDBBSA-N. The full InChI is InChI=1S/C10H9F2N5/c1-5-8(10(13)17-14-5)15-16-9-6(11)3-2-4-7(9)12/h2-4H,1H3,(H3,13,14,17)/b16-15+.
What are the key properties of 4-[(2,6-difluorophenyl)diazenyl]-5-methyl-1H-pyrazol-3-amine?
4-[(2,6-difluorophenyl)diazenyl]-5-methyl-1H-pyrazol-3-amine has a molecular weight of 237.21 g/mol, XLogP of 2.99, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,6-difluorophenyl)diazenyl]-5-methyl-1H-pyrazol-3-amine is sourced from PubChem (CID 170279040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).