C15H27NO — CID 170279098
(Z)-1-[[(2Z,4Z)-4-ethylhepta-2,4-dienyl]amino]-3-methylpent-1-en-3-ol (PubChem CID 170279098) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is (Z)-1-[[(2Z,4Z)-4-ethylhepta-2,4-dienyl]amino]-3-methylpent-1-en-3-ol.
| Compound Name | (Z)-1-[[(2Z,4Z)-4-ethylhepta-2,4-dienyl]amino]-3-methylpent-1-en-3-ol |
|---|---|
| PubChem CID | 170279098 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | (Z)-1-[[(2Z,4Z)-4-ethylhepta-2,4-dienyl]amino]-3-methylpent-1-en-3-ol |
| SMILES | CC/C=C(\C=C/CN/C=C\C(C)(O)CC)CC |
| InChI | InChI=1S/C15H27NO/c1-5-9-14(6-2)10-8-12-16-13-11-15(4,17)7-3/h8-11,13,16-17H,5-7,12H2,1-4H3/b10-8-,13-11-,14-9- |
| InChIKey | CVBOKXHPUFVEEE-JPADMCAQSA-N |
| XLogP | 3.55 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|