C53H48N2 — CID 170279466
9,9-dimethyl-N,N-diphenyl-7-[9-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbazol-2-yl]fluoren-2-amine (PubChem CID 170279466) has the molecular formula C53H48N2 and a molecular weight of 712.98 g/mol. Its IUPAC name is 9,9-dimethyl-N,N-diphenyl-7-[9-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbazol-2-yl]fluoren-2-amine.
| Compound Name | 9,9-dimethyl-N,N-diphenyl-7-[9-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbazol-2-yl]fluoren-2-amine |
|---|---|
| PubChem CID | 170279466 |
| Molecular Formula | C53H48N2 |
| Molecular Weight | 712.98 g/mol |
| Exact Mass | 712.38 |
| IUPAC Name | 9,9-dimethyl-N,N-diphenyl-7-[9-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbazol-2-yl]fluoren-2-amine |
| SMILES | CC1(C)CCC(C)(C)c2cc(-n3c4ccccc4c4ccc(-c5ccc6c(c5)C(C)(C)c5cc(N(c7ccccc7)c7ccccc7)ccc5-6)cc43)ccc21 |
| InChI | InChI=1S/C53H48N2/c1-51(2)29-30-52(3,4)48-34-40(24-28-45(48)51)55-49-20-14-13-19-43(49)44-26-22-36(32-50(44)55)35-21-25-41-42-27-23-39(33-47(42)53(5,6)46(41)31-35)54(37-15-9-7-10-16-37)38-17-11-8-12-18-38/h7-28,31-34H,29-30H2,1-6H3 |
| InChIKey | FJZFNDBCYXVACJ-UHFFFAOYSA-N |
| XLogP | 14.58 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.98 |
| LogP ≤ 5 | 14.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |