C55H50N2 — CID 170279613
N-cyclohexa-1,3-dien-1-yl-4-phenyl-N-[4-[4-[9-(1,1,3,3-tetramethyl-2H-inden-5-yl)-4a,9a-dihydrocarbazol-3-yl]phenyl]phenyl]aniline (PubChem CID 170279613) has the molecular formula C55H50N2 and a molecular weight of 739.02 g/mol. Its IUPAC name is N-cyclohexa-1,3-dien-1-yl-4-phenyl-N-[4-[4-[9-(1,1,3,3-tetramethyl-2H-inden-5-yl)-4a,9a-dihydrocarbazol-3-yl]phenyl]phenyl]aniline.
| Compound Name | N-cyclohexa-1,3-dien-1-yl-4-phenyl-N-[4-[4-[9-(1,1,3,3-tetramethyl-2H-inden-5-yl)-4a,9a-dihydrocarbazol-3-yl]phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 170279613 |
| Molecular Formula | C55H50N2 |
| Molecular Weight | 739.02 g/mol |
| Exact Mass | 738.40 |
| IUPAC Name | N-cyclohexa-1,3-dien-1-yl-4-phenyl-N-[4-[4-[9-(1,1,3,3-tetramethyl-2H-inden-5-yl)-4a,9a-dihydrocarbazol-3-yl]phenyl]phenyl]aniline |
| SMILES | CC1(C)CC(C)(C)c2cc(N3c4ccccc4C4C=C(c5ccc(-c6ccc(N(C7=CC=CCC7)c7ccc(-c8ccccc8)cc7)cc6)cc5)C=CC43)ccc21 |
| InChI | InChI=1S/C55H50N2/c1-54(2)37-55(3,4)51-36-47(32-33-50(51)54)57-52-18-12-11-17-48(52)49-35-43(27-34-53(49)57)42-21-19-39(20-22-42)41-25-30-46(31-26-41)56(44-15-9-6-10-16-44)45-28-23-40(24-29-45)38-13-7-5-8-14-38/h5-9,11-15,17-36,49,53H,10,16,37H2,1-4H3 |
| InChIKey | QETICTSBAGIODN-UHFFFAOYSA-N |
| XLogP | 14.61 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.02 |
| LogP ≤ 5 | 14.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |