About (4E,5E)-2-tert-butyl-4-ethylidene-5-prop-2-enylidene-1,3-thiazolidine
(4E,5E)-2-tert-butyl-4-ethylidene-5-prop-2-enylidene-1,3-thiazolidine (PubChem CID 170279800) has the molecular formula C12H19NS
and a molecular weight of 209.36 g/mol. Its IUPAC name is (4E,5E)-2-tert-butyl-4-ethylidene-5-prop-2-enylidene-1,3-thiazolidine.
Molecular Properties
| Compound Name | (4E,5E)-2-tert-butyl-4-ethylidene-5-prop-2-enylidene-1,3-thiazolidine |
| PubChem CID | 170279800 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (4E,5E)-2-tert-butyl-4-ethylidene-5-prop-2-enylidene-1,3-thiazolidine |
| SMILES | C=C/C=C1/SC(C(C)(C)C)N/C1=C/C |
| InChI | InChI=1S/C12H19NS/c1-6-8-10-9(7-2)13-11(14-10)12(3,4)5/h6-8,11,13H,1H2,2-5H3/b9-7+,10-8+ |
| InChIKey | FWXJEQZBQSFSSQ-FIFLTTCUSA-N |
| XLogP | 3.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4E,5E)-2-tert-butyl-4-ethylidene-5-prop-2-enylidene-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,5E)-2-tert-butyl-4-ethylidene-5-prop-2-enylidene-1,3-thiazolidine?
The IUPAC name of (4E,5E)-2-tert-butyl-4-ethylidene-5-prop-2-enylidene-1,3-thiazolidine (CID 170279800) is (4E,5E)-2-tert-butyl-4-ethylidene-5-prop-2-enylidene-1,3-thiazolidine.
What is the SMILES notation for (4E,5E)-2-tert-butyl-4-ethylidene-5-prop-2-enylidene-1,3-thiazolidine?
The canonical SMILES for (4E,5E)-2-tert-butyl-4-ethylidene-5-prop-2-enylidene-1,3-thiazolidine is C=C/C=C1/SC(C(C)(C)C)N/C1=C/C.
What is the InChIKey of (4E,5E)-2-tert-butyl-4-ethylidene-5-prop-2-enylidene-1,3-thiazolidine?
The InChIKey is FWXJEQZBQSFSSQ-FIFLTTCUSA-N. The full InChI is InChI=1S/C12H19NS/c1-6-8-10-9(7-2)13-11(14-10)12(3,4)5/h6-8,11,13H,1H2,2-5H3/b9-7+,10-8+.
What are the key properties of (4E,5E)-2-tert-butyl-4-ethylidene-5-prop-2-enylidene-1,3-thiazolidine?
(4E,5E)-2-tert-butyl-4-ethylidene-5-prop-2-enylidene-1,3-thiazolidine has a molecular weight of 209.36 g/mol, XLogP of 3.67, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,5E)-2-tert-butyl-4-ethylidene-5-prop-2-enylidene-1,3-thiazolidine is sourced from PubChem (CID 170279800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).