C23H20INO5S2 — CID 170279820
iodo 2-[(4-methylsulfonylbenzoyl)amino]-4-(1,2,3,4-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate (PubChem CID 170279820) has the molecular formula C23H20INO5S2 and a molecular weight of 581.45 g/mol. Its IUPAC name is iodo 2-[(4-methylsulfonylbenzoyl)amino]-4-(1,2,3,4-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate.
| Compound Name | iodo 2-[(4-methylsulfonylbenzoyl)amino]-4-(1,2,3,4-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 170279820 |
| Molecular Formula | C23H20INO5S2 |
| Molecular Weight | 581.45 g/mol |
| Exact Mass | 580.98 |
| IUPAC Name | iodo 2-[(4-methylsulfonylbenzoyl)amino]-4-(1,2,3,4-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2scc(C3CCc4ccccc4C3)c2C(=O)OI)cc1 |
| InChI | InChI=1S/C23H20INO5S2/c1-32(28,29)18-10-8-15(9-11-18)21(26)25-22-20(23(27)30-24)19(13-31-22)17-7-6-14-4-2-3-5-16(14)12-17/h2-5,8-11,13,17H,6-7,12H2,1H3,(H,25,26) |
| InChIKey | ZFBLJVANNVDNSW-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|