C17H12FN3O — CID 170280646
3-[(2S)-2-amino-2-cyanoethyl]-2-fluoro-6H-benzo[c]chromene-8-carbonitrile (PubChem CID 170280646) has the molecular formula C17H12FN3O and a molecular weight of 293.30 g/mol. Its IUPAC name is 3-[(2S)-2-amino-2-cyanoethyl]-2-fluoro-6H-benzo[c]chromene-8-carbonitrile.
| Compound Name | 3-[(2S)-2-amino-2-cyanoethyl]-2-fluoro-6H-benzo[c]chromene-8-carbonitrile |
|---|---|
| PubChem CID | 170280646 |
| Molecular Formula | C17H12FN3O |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 3-[(2S)-2-amino-2-cyanoethyl]-2-fluoro-6H-benzo[c]chromene-8-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)COc1cc(C[C@H](N)C#N)c(F)cc1-2 |
| InChI | InChI=1S/C17H12FN3O/c18-16-6-15-14-2-1-10(7-19)3-12(14)9-22-17(15)5-11(16)4-13(21)8-20/h1-3,5-6,13H,4,9,21H2/t13-/m0/s1 |
| InChIKey | DHCACRKVPDIKJS-ZDUSSCGKSA-N |
| XLogP | 2.65 |
| TPSA | 82.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |