C14H28N2 — CID 170281020
(Z)-2-[(4-ethyl-2,2,5,5-tetramethylhexan-3-ylidene)amino]ethenamine (PubChem CID 170281020) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is (Z)-2-[(4-ethyl-2,2,5,5-tetramethylhexan-3-ylidene)amino]ethenamine.
| Compound Name | (Z)-2-[(4-ethyl-2,2,5,5-tetramethylhexan-3-ylidene)amino]ethenamine |
|---|---|
| PubChem CID | 170281020 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | (Z)-2-[(4-ethyl-2,2,5,5-tetramethylhexan-3-ylidene)amino]ethenamine |
| SMILES | CCC(/C(=N/C=C\N)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H28N2/c1-8-11(13(2,3)4)12(14(5,6)7)16-10-9-15/h9-11H,8,15H2,1-7H3/b10-9-,16-12- |
| InChIKey | QDNBCNUAWWXHFN-ZQJDLNAESA-N |
| XLogP | 3.98 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|