C27H27F2N5O4 — CID 170281029
(3S)-3-[3',3'-difluoro-6-hydroxy-1'-(1H-indazol-5-ylmethyl)spiro[6,8-dihydro-2H-furo[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione (PubChem CID 170281029) has the molecular formula C27H27F2N5O4 and a molecular weight of 523.54 g/mol. Its IUPAC name is (3S)-3-[3',3'-difluoro-6-hydroxy-1'-(1H-indazol-5-ylmethyl)spiro[6,8-dihydro-2H-furo[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione.
| Compound Name | (3S)-3-[3',3'-difluoro-6-hydroxy-1'-(1H-indazol-5-ylmethyl)spiro[6,8-dihydro-2H-furo[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170281029 |
| Molecular Formula | C27H27F2N5O4 |
| Molecular Weight | 523.54 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | (3S)-3-[3',3'-difluoro-6-hydroxy-1'-(1H-indazol-5-ylmethyl)spiro[6,8-dihydro-2H-furo[2,3-e]isoindole-3,4'-piperidine]-7-yl]piperidine-2,6-dione |
| SMILES | O=C1CC[C@H](N2Cc3c(ccc4c3OCC43CCN(Cc4ccc5[nH]ncc5c4)CC3(F)F)C2O)C(=O)N1 |
| InChI | InChI=1S/C27H27F2N5O4/c28-27(29)13-33(11-15-1-4-20-16(9-15)10-30-32-20)8-7-26(27)14-38-23-18-12-34(21-5-6-22(35)31-24(21)36)25(37)17(18)2-3-19(23)26/h1-4,9-10,21,25,37H,5-8,11-14H2,(H,30,32)(H,31,35,36)/t21-,25?,26?/m0/s1 |
| InChIKey | VGVPWFLCGOIMCJ-PMWKKSSLSA-N |
| XLogP | 2.35 |
| TPSA | 110.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.54 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|