C23H22F2N2O3 — CID 170281061
2-[[[4-cyano-7-[4-[(2S)-3,3-difluorobutan-2-yl]phenyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]prop-2-enoic acid (PubChem CID 170281061) has the molecular formula C23H22F2N2O3 and a molecular weight of 412.44 g/mol. Its IUPAC name is 2-[[[4-cyano-7-[4-[(2S)-3,3-difluorobutan-2-yl]phenyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]prop-2-enoic acid.
| Compound Name | 2-[[[4-cyano-7-[4-[(2S)-3,3-difluorobutan-2-yl]phenyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 170281061 |
| Molecular Formula | C23H22F2N2O3 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2-[[[4-cyano-7-[4-[(2S)-3,3-difluorobutan-2-yl]phenyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]prop-2-enoic acid |
| SMILES | C=C(CNc1cc(-c2ccc([C@H](C)C(C)(F)F)cc2)c2c(c1C#N)CCO2)C(=O)O |
| InChI | InChI=1S/C23H22F2N2O3/c1-13(22(28)29)12-27-20-10-18(21-17(8-9-30-21)19(20)11-26)16-6-4-15(5-7-16)14(2)23(3,24)25/h4-7,10,14,27H,1,8-9,12H2,2-3H3,(H,28,29)/t14-/m0/s1 |
| InChIKey | GQIWZVOORHKTDI-AWEZNQCLSA-N |
| XLogP | 4.97 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|