C22H21F2N3O4 — CID 170281090
2-[[[4-cyano-7-[4-(1,1-difluoroethoxy)phenyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]-N-hydroxy-N-methylprop-2-enamide (PubChem CID 170281090) has the molecular formula C22H21F2N3O4 and a molecular weight of 429.42 g/mol. Its IUPAC name is 2-[[[4-cyano-7-[4-(1,1-difluoroethoxy)phenyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]-N-hydroxy-N-methylprop-2-enamide.
| Compound Name | 2-[[[4-cyano-7-[4-(1,1-difluoroethoxy)phenyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]-N-hydroxy-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 170281090 |
| Molecular Formula | C22H21F2N3O4 |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 2-[[[4-cyano-7-[4-(1,1-difluoroethoxy)phenyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]-N-hydroxy-N-methylprop-2-enamide |
| SMILES | C=C(CNc1cc(-c2ccc(OC(C)(F)F)cc2)c2c(c1C#N)CCO2)C(=O)N(C)O |
| InChI | InChI=1S/C22H21F2N3O4/c1-13(21(28)27(3)29)12-26-19-10-17(20-16(8-9-30-20)18(19)11-25)14-4-6-15(7-5-14)31-22(2,23)24/h4-7,10,26,29H,1,8-9,12H2,2-3H3 |
| InChIKey | XTYAFFVSQHZUPG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|