C26H41N5O6 — CID 170282048
[(2R,3S,4R,5S)-2-[(2-cyclohexylacetyl)oxymethyl]-4-hydroxy-5-[5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]-5-methyloxolan-3-yl] (2S)-2-amino-3,3-dimethylbutanoate (PubChem CID 170282048) has the molecular formula C26H41N5O6 and a molecular weight of 519.64 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-2-[(2-cyclohexylacetyl)oxymethyl]-4-hydroxy-5-[5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]-5-methyloxolan-3-yl] (2S)-2-amino-3,3-dimethylbutanoate.
| Compound Name | [(2R,3S,4R,5S)-2-[(2-cyclohexylacetyl)oxymethyl]-4-hydroxy-5-[5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]-5-methyloxolan-3-yl] (2S)-2-amino-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 170282048 |
| Molecular Formula | C26H41N5O6 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.31 |
| IUPAC Name | [(2R,3S,4R,5S)-2-[(2-cyclohexylacetyl)oxymethyl]-4-hydroxy-5-[5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]-5-methyloxolan-3-yl] (2S)-2-amino-3,3-dimethylbutanoate |
| SMILES | [H]/N=C/N=C(\N)c1ccc([C@]2(C)O[C@H](COC(=O)CC3CCCCC3)[C@@H](OC(=O)[C@@H](N)C(C)(C)C)[C@H]2O)[nH]1 |
| InChI | InChI=1S/C26H41N5O6/c1-25(2,3)21(28)24(34)36-20-17(13-35-19(32)12-15-8-6-5-7-9-15)37-26(4,22(20)33)18-11-10-16(31-18)23(29)30-14-27/h10-11,14-15,17,20-22,31,33H,5-9,12-13,28H2,1-4H3,(H3,27,29,30)/t17-,20-,21-,22-,26+/m1/s1 |
| InChIKey | YWRWGESJJTUDEG-GYPUHBRYSA-N |
| XLogP | 2.10 |
| TPSA | 186.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|