C54H40N4O — CID 170282863
5-[9-[2-cyclohexa-1,5-dien-1-yl-4-(4-phenylphenyl)-1,2-dihydro-1,3,5-triazin-6-yl]dibenzofuran-3-yl]-11,11-dimethylindeno[1,2-b]carbazole (PubChem CID 170282863) has the molecular formula C54H40N4O and a molecular weight of 760.94 g/mol. Its IUPAC name is 5-[9-[2-cyclohexa-1,5-dien-1-yl-4-(4-phenylphenyl)-1,2-dihydro-1,3,5-triazin-6-yl]dibenzofuran-3-yl]-11,11-dimethylindeno[1,2-b]carbazole.
| Compound Name | 5-[9-[2-cyclohexa-1,5-dien-1-yl-4-(4-phenylphenyl)-1,2-dihydro-1,3,5-triazin-6-yl]dibenzofuran-3-yl]-11,11-dimethylindeno[1,2-b]carbazole |
|---|---|
| PubChem CID | 170282863 |
| Molecular Formula | C54H40N4O |
| Molecular Weight | 760.94 g/mol |
| Exact Mass | 760.32 |
| IUPAC Name | 5-[9-[2-cyclohexa-1,5-dien-1-yl-4-(4-phenylphenyl)-1,2-dihydro-1,3,5-triazin-6-yl]dibenzofuran-3-yl]-11,11-dimethylindeno[1,2-b]carbazole |
| SMILES | CC1(C)c2ccccc2-c2cc3c(cc21)c1ccccc1n3-c1ccc2c(c1)oc1cccc(C3=NC(c4ccc(-c5ccccc5)cc4)=NC(C4=CCCC=C4)N3)c12 |
| InChI | InChI=1S/C54H40N4O/c1-54(2)44-21-11-9-18-38(44)42-32-47-43(31-45(42)54)39-19-10-12-22-46(39)58(47)37-28-29-40-49(30-37)59-48-23-13-20-41(50(40)48)53-56-51(35-16-7-4-8-17-35)55-52(57-53)36-26-24-34(25-27-36)33-14-5-3-6-15-33/h3,5-7,9-32,51H,4,8H2,1-2H3,(H,55,56,57) |
| InChIKey | FRVRLONUCWQKOS-UHFFFAOYSA-N |
| XLogP | 13.06 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.94 |
| LogP ≤ 5 | 13.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |