C21H19ClF3N3O — CID 17028444
1-(7-chloro-2,3-dimethylindol-1-yl)-3-[2-(trifluoromethyl)benzimidazol-1-yl]propan-2-ol (PubChem CID 17028444) has the molecular formula C21H19ClF3N3O and a molecular weight of 421.85 g/mol. Its IUPAC name is 1-(7-chloro-2,3-dimethylindol-1-yl)-3-[2-(trifluoromethyl)benzimidazol-1-yl]propan-2-ol.
| Compound Name | 1-(7-chloro-2,3-dimethylindol-1-yl)-3-[2-(trifluoromethyl)benzimidazol-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 17028444 |
| Molecular Formula | C21H19ClF3N3O |
| Molecular Weight | 421.85 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 1-(7-chloro-2,3-dimethylindol-1-yl)-3-[2-(trifluoromethyl)benzimidazol-1-yl]propan-2-ol |
| SMILES | Cc1c(C)n(CC(O)Cn2c(C(F)(F)F)nc3ccccc32)c2c(Cl)cccc12 |
| InChI | InChI=1S/C21H19ClF3N3O/c1-12-13(2)27(19-15(12)6-5-7-16(19)22)10-14(29)11-28-18-9-4-3-8-17(18)26-20(28)21(23,24)25/h3-9,14,29H,10-11H2,1-2H3 |
| InChIKey | MNAKGXLXOVFJJS-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 42.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.85 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|