C19H23N3O6 — CID 17028448
ethyl 5-[3-(2,5-dioxoimidazolidin-1-yl)-2-hydroxypropoxy]-1,2-dimethylindole-3-carboxylate (PubChem CID 17028448) has the molecular formula C19H23N3O6 and a molecular weight of 389.41 g/mol. Its IUPAC name is ethyl 5-[3-(2,5-dioxoimidazolidin-1-yl)-2-hydroxypropoxy]-1,2-dimethylindole-3-carboxylate.
| Compound Name | ethyl 5-[3-(2,5-dioxoimidazolidin-1-yl)-2-hydroxypropoxy]-1,2-dimethylindole-3-carboxylate |
|---|---|
| PubChem CID | 17028448 |
| Molecular Formula | C19H23N3O6 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | ethyl 5-[3-(2,5-dioxoimidazolidin-1-yl)-2-hydroxypropoxy]-1,2-dimethylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(C)c2ccc(OCC(O)CN3C(=O)CNC3=O)cc12 |
| InChI | InChI=1S/C19H23N3O6/c1-4-27-18(25)17-11(2)21(3)15-6-5-13(7-14(15)17)28-10-12(23)9-22-16(24)8-20-19(22)26/h5-7,12,23H,4,8-10H2,1-3H3,(H,20,26) |
| InChIKey | MTELRKAINVBROJ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|