About N-(2-aminocyclohexa-1,3-dien-1-yl)methanesulfonamide
N-(2-aminocyclohexa-1,3-dien-1-yl)methanesulfonamide (PubChem CID 170284504) has the molecular formula C7H12N2O2S
and a molecular weight of 188.25 g/mol. Its IUPAC name is N-(2-aminocyclohexa-1,3-dien-1-yl)methanesulfonamide.
Molecular Properties
| Compound Name | N-(2-aminocyclohexa-1,3-dien-1-yl)methanesulfonamide |
| PubChem CID | 170284504 |
| Molecular Formula | C7H12N2O2S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | N-(2-aminocyclohexa-1,3-dien-1-yl)methanesulfonamide |
| SMILES | CS(=O)(=O)NC1=C(N)C=CCC1 |
| InChI | InChI=1S/C7H12N2O2S/c1-12(10,11)9-7-5-3-2-4-6(7)8/h2,4,9H,3,5,8H2,1H3 |
| InChIKey | OIJHTWOZLXYUOQ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-aminocyclohexa-1,3-dien-1-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminocyclohexa-1,3-dien-1-yl)methanesulfonamide?
The IUPAC name of N-(2-aminocyclohexa-1,3-dien-1-yl)methanesulfonamide (CID 170284504) is N-(2-aminocyclohexa-1,3-dien-1-yl)methanesulfonamide.
What is the SMILES notation for N-(2-aminocyclohexa-1,3-dien-1-yl)methanesulfonamide?
The canonical SMILES for N-(2-aminocyclohexa-1,3-dien-1-yl)methanesulfonamide is CS(=O)(=O)NC1=C(N)C=CCC1.
What is the InChIKey of N-(2-aminocyclohexa-1,3-dien-1-yl)methanesulfonamide?
The InChIKey is OIJHTWOZLXYUOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2S/c1-12(10,11)9-7-5-3-2-4-6(7)8/h2,4,9H,3,5,8H2,1H3.
What are the key properties of N-(2-aminocyclohexa-1,3-dien-1-yl)methanesulfonamide?
N-(2-aminocyclohexa-1,3-dien-1-yl)methanesulfonamide has a molecular weight of 188.25 g/mol, XLogP of 0.06, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminocyclohexa-1,3-dien-1-yl)methanesulfonamide is sourced from PubChem (CID 170284504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).