About N-propan-2-yl-2-(2,5,6-trimethylbenzimidazol-1-yl)acetamide
N-propan-2-yl-2-(2,5,6-trimethylbenzimidazol-1-yl)acetamide (PubChem CID 17028520) has the molecular formula C15H21N3O
and a molecular weight of 259.35 g/mol. Its IUPAC name is N-propan-2-yl-2-(2,5,6-trimethylbenzimidazol-1-yl)acetamide.
Molecular Properties
| Compound Name | N-propan-2-yl-2-(2,5,6-trimethylbenzimidazol-1-yl)acetamide |
| PubChem CID | 17028520 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | N-propan-2-yl-2-(2,5,6-trimethylbenzimidazol-1-yl)acetamide |
| SMILES | Cc1cc2nc(C)n(CC(=O)NC(C)C)c2cc1C |
| InChI | InChI=1S/C15H21N3O/c1-9(2)16-15(19)8-18-12(5)17-13-6-10(3)11(4)7-14(13)18/h6-7,9H,8H2,1-5H3,(H,16,19) |
| InChIKey | HTYJZMFFKACVQV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-propan-2-yl-2-(2,5,6-trimethylbenzimidazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-yl-2-(2,5,6-trimethylbenzimidazol-1-yl)acetamide?
The IUPAC name of N-propan-2-yl-2-(2,5,6-trimethylbenzimidazol-1-yl)acetamide (CID 17028520) is N-propan-2-yl-2-(2,5,6-trimethylbenzimidazol-1-yl)acetamide.
What is the SMILES notation for N-propan-2-yl-2-(2,5,6-trimethylbenzimidazol-1-yl)acetamide?
The canonical SMILES for N-propan-2-yl-2-(2,5,6-trimethylbenzimidazol-1-yl)acetamide is Cc1cc2nc(C)n(CC(=O)NC(C)C)c2cc1C.
What is the InChIKey of N-propan-2-yl-2-(2,5,6-trimethylbenzimidazol-1-yl)acetamide?
The InChIKey is HTYJZMFFKACVQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O/c1-9(2)16-15(19)8-18-12(5)17-13-6-10(3)11(4)7-14(13)18/h6-7,9H,8H2,1-5H3,(H,16,19).
What are the key properties of N-propan-2-yl-2-(2,5,6-trimethylbenzimidazol-1-yl)acetamide?
N-propan-2-yl-2-(2,5,6-trimethylbenzimidazol-1-yl)acetamide has a molecular weight of 259.35 g/mol, XLogP of 2.49, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-yl-2-(2,5,6-trimethylbenzimidazol-1-yl)acetamide is sourced from PubChem (CID 17028520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).