About 2-[(E)-but-1-enyl]-N,5-dimethylaniline
2-[(E)-but-1-enyl]-N,5-dimethylaniline (PubChem CID 170285735) has the molecular formula C12H17N
and a molecular weight of 175.27 g/mol. Its IUPAC name is 2-[(E)-but-1-enyl]-N,5-dimethylaniline.
Molecular Properties
| Compound Name | 2-[(E)-but-1-enyl]-N,5-dimethylaniline |
| PubChem CID | 170285735 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 2-[(E)-but-1-enyl]-N,5-dimethylaniline |
| SMILES | CC/C=C/c1ccc(C)cc1NC |
| InChI | InChI=1S/C12H17N/c1-4-5-6-11-8-7-10(2)9-12(11)13-3/h5-9,13H,4H2,1-3H3/b6-5+ |
| InChIKey | SYZMVXAGOOKILK-AATRIKPKSA-N |
| XLogP | 3.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(E)-but-1-enyl]-N,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-but-1-enyl]-N,5-dimethylaniline?
The IUPAC name of 2-[(E)-but-1-enyl]-N,5-dimethylaniline (CID 170285735) is 2-[(E)-but-1-enyl]-N,5-dimethylaniline.
What is the SMILES notation for 2-[(E)-but-1-enyl]-N,5-dimethylaniline?
The canonical SMILES for 2-[(E)-but-1-enyl]-N,5-dimethylaniline is CC/C=C/c1ccc(C)cc1NC.
What is the InChIKey of 2-[(E)-but-1-enyl]-N,5-dimethylaniline?
The InChIKey is SYZMVXAGOOKILK-AATRIKPKSA-N. The full InChI is InChI=1S/C12H17N/c1-4-5-6-11-8-7-10(2)9-12(11)13-3/h5-9,13H,4H2,1-3H3/b6-5+.
What are the key properties of 2-[(E)-but-1-enyl]-N,5-dimethylaniline?
2-[(E)-but-1-enyl]-N,5-dimethylaniline has a molecular weight of 175.27 g/mol, XLogP of 3.46, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-but-1-enyl]-N,5-dimethylaniline is sourced from PubChem (CID 170285735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).