C19H25N — CID 170285804
(2E,4E)-4-(3-cyclohexa-1,5-dien-1-ylpropyl)-3-prop-1-en-2-ylhepta-2,4,6-trien-1-imine (PubChem CID 170285804) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is (2E,4E)-4-(3-cyclohexa-1,5-dien-1-ylpropyl)-3-prop-1-en-2-ylhepta-2,4,6-trien-1-imine.
| Compound Name | (2E,4E)-4-(3-cyclohexa-1,5-dien-1-ylpropyl)-3-prop-1-en-2-ylhepta-2,4,6-trien-1-imine |
|---|---|
| PubChem CID | 170285804 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | (2E,4E)-4-(3-cyclohexa-1,5-dien-1-ylpropyl)-3-prop-1-en-2-ylhepta-2,4,6-trien-1-imine |
| SMILES | [H]/N=C/C=C(C(=C)C)/C(=C/C=C)CCCC1=CCCC=C1 |
| InChI | InChI=1S/C19H25N/c1-4-9-18(19(14-15-20)16(2)3)13-8-12-17-10-6-5-7-11-17/h4,6,9-11,14-15,20H,1-2,5,7-8,12-13H2,3H3/b18-9+,19-14+,20-15+ |
| InChIKey | IWGKRFLPZXTXQN-VTHXPALJSA-N |
| XLogP | 5.70 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|