C24H35NO6 — CID 170286654
1-O-tert-butyl 4-O-ethyl (3S,4R)-3-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]piperidine-1,4-dicarboxylate (PubChem CID 170286654) has the molecular formula C24H35NO6 and a molecular weight of 433.55 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-ethyl (3S,4R)-3-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]piperidine-1,4-dicarboxylate.
| Compound Name | 1-O-tert-butyl 4-O-ethyl (3S,4R)-3-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]piperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 170286654 |
| Molecular Formula | C24H35NO6 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 1-O-tert-butyl 4-O-ethyl (3S,4R)-3-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]piperidine-1,4-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1CCN(C(=O)OC(C)(C)C)C[C@@H]1c1ccc(C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H35NO6/c1-8-29-21(27)18-13-14-25(22(28)31-24(5,6)7)15-19(18)16-9-11-17(12-10-16)20(26)30-23(2,3)4/h9-12,18-19H,8,13-15H2,1-7H3/t18-,19-/m1/s1 |
| InChIKey | BOWRGHPLAUYTAZ-RTBURBONSA-N |
| XLogP | 4.55 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|