C20H24BrN3 — CID 170286947
6-(4-bromo-3,4-dihydropyridin-6-yl)-2-[(Z)-but-2-enyl]-4-(4-methylcyclohexa-2,4-dien-1-yl)-1,4-dihydropyrimidine (PubChem CID 170286947) has the molecular formula C20H24BrN3 and a molecular weight of 386.34 g/mol. Its IUPAC name is 6-(4-bromo-3,4-dihydropyridin-6-yl)-2-[(Z)-but-2-enyl]-4-(4-methylcyclohexa-2,4-dien-1-yl)-1,4-dihydropyrimidine.
| Compound Name | 6-(4-bromo-3,4-dihydropyridin-6-yl)-2-[(Z)-but-2-enyl]-4-(4-methylcyclohexa-2,4-dien-1-yl)-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 170286947 |
| Molecular Formula | C20H24BrN3 |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 6-(4-bromo-3,4-dihydropyridin-6-yl)-2-[(Z)-but-2-enyl]-4-(4-methylcyclohexa-2,4-dien-1-yl)-1,4-dihydropyrimidine |
| SMILES | C/C=C\CC1=NC(C2C=CC(C)=CC2)C=C(C2=CC(Br)CC=N2)N1 |
| InChI | InChI=1S/C20H24BrN3/c1-3-4-5-20-23-17(15-8-6-14(2)7-9-15)13-19(24-20)18-12-16(21)10-11-22-18/h3-4,6-8,11-13,15-17H,5,9-10H2,1-2H3,(H,23,24)/b4-3- |
| InChIKey | DPNZVKYUUFOODK-ARJAWSKDSA-N |
| XLogP | 4.85 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|