C23H32N2 — CID 170288713
N,N-dimethyl-1-(1,2,4,5,6,7,8,9-octamethylcarbazol-3-yl)methanamine (PubChem CID 170288713) has the molecular formula C23H32N2 and a molecular weight of 336.52 g/mol. Its IUPAC name is N,N-dimethyl-1-(1,2,4,5,6,7,8,9-octamethylcarbazol-3-yl)methanamine.
| Compound Name | N,N-dimethyl-1-(1,2,4,5,6,7,8,9-octamethylcarbazol-3-yl)methanamine |
|---|---|
| PubChem CID | 170288713 |
| Molecular Formula | C23H32N2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.26 |
| IUPAC Name | N,N-dimethyl-1-(1,2,4,5,6,7,8,9-octamethylcarbazol-3-yl)methanamine |
| SMILES | Cc1c(C)c(C)c2c(c1C)c1c(C)c(CN(C)C)c(C)c(C)c1n2C |
| InChI | InChI=1S/C23H32N2/c1-12-13(2)16(5)22-20(15(12)4)21-18(7)19(11-24(8)9)14(3)17(6)23(21)25(22)10/h11H2,1-10H3 |
| InChIKey | IPKZVHCMQPMPNS-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |