C52H53N — CID 170288774
4-tert-butyl-N-[2-[8-(3,5-ditert-butylphenyl)naphthalen-1-yl]phenyl]-N,2-diphenylaniline (PubChem CID 170288774) has the molecular formula C52H53N and a molecular weight of 692.00 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-[8-(3,5-ditert-butylphenyl)naphthalen-1-yl]phenyl]-N,2-diphenylaniline.
| Compound Name | 4-tert-butyl-N-[2-[8-(3,5-ditert-butylphenyl)naphthalen-1-yl]phenyl]-N,2-diphenylaniline |
|---|---|
| PubChem CID | 170288774 |
| Molecular Formula | C52H53N |
| Molecular Weight | 692.00 g/mol |
| Exact Mass | 691.42 |
| IUPAC Name | 4-tert-butyl-N-[2-[8-(3,5-ditert-butylphenyl)naphthalen-1-yl]phenyl]-N,2-diphenylaniline |
| SMILES | CC(C)(C)c1cc(-c2cccc3cccc(-c4ccccc4N(c4ccccc4)c4ccc(C(C)(C)C)cc4-c4ccccc4)c23)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C52H53N/c1-50(2,3)39-30-31-48(46(35-39)36-20-12-10-13-21-36)53(42-24-14-11-15-25-42)47-29-17-16-26-44(47)45-28-19-23-37-22-18-27-43(49(37)45)38-32-40(51(4,5)6)34-41(33-38)52(7,8)9/h10-35H,1-9H3 |
| InChIKey | LFKPSGXUJIFFMA-UHFFFAOYSA-N |
| XLogP | 15.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.00 |
| LogP ≤ 5 | 15.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |