About 1-[1-[2-tert-butyl-3-(trifluoromethyl)phenyl]-2-methylpropan-2-yl]-3,5-difluorobenzene
1-[1-[2-tert-butyl-3-(trifluoromethyl)phenyl]-2-methylpropan-2-yl]-3,5-difluorobenzene (PubChem CID 170290026) has the molecular formula C21H23F5
and a molecular weight of 370.41 g/mol. Its IUPAC name is 1-[1-[2-tert-butyl-3-(trifluoromethyl)phenyl]-2-methylpropan-2-yl]-3,5-difluorobenzene.
Molecular Properties
| Compound Name | 1-[1-[2-tert-butyl-3-(trifluoromethyl)phenyl]-2-methylpropan-2-yl]-3,5-difluorobenzene |
| PubChem CID | 170290026 |
| Molecular Formula | C21H23F5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 1-[1-[2-tert-butyl-3-(trifluoromethyl)phenyl]-2-methylpropan-2-yl]-3,5-difluorobenzene |
| SMILES | CC(C)(C)c1c(CC(C)(C)c2cc(F)cc(F)c2)cccc1C(F)(F)F |
| InChI | InChI=1S/C21H23F5/c1-19(2,3)18-13(7-6-8-17(18)21(24,25)26)12-20(4,5)14-9-15(22)11-16(23)10-14/h6-11H,12H2,1-5H3 |
| InChIKey | YLYWAZFEEUMEOB-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-[1-[2-tert-butyl-3-(trifluoromethyl)phenyl]-2-methylpropan-2-yl]-3,5-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[2-tert-butyl-3-(trifluoromethyl)phenyl]-2-methylpropan-2-yl]-3,5-difluorobenzene?
The IUPAC name of 1-[1-[2-tert-butyl-3-(trifluoromethyl)phenyl]-2-methylpropan-2-yl]-3,5-difluorobenzene (CID 170290026) is 1-[1-[2-tert-butyl-3-(trifluoromethyl)phenyl]-2-methylpropan-2-yl]-3,5-difluorobenzene.
What is the SMILES notation for 1-[1-[2-tert-butyl-3-(trifluoromethyl)phenyl]-2-methylpropan-2-yl]-3,5-difluorobenzene?
The canonical SMILES for 1-[1-[2-tert-butyl-3-(trifluoromethyl)phenyl]-2-methylpropan-2-yl]-3,5-difluorobenzene is CC(C)(C)c1c(CC(C)(C)c2cc(F)cc(F)c2)cccc1C(F)(F)F.
What is the InChIKey of 1-[1-[2-tert-butyl-3-(trifluoromethyl)phenyl]-2-methylpropan-2-yl]-3,5-difluorobenzene?
The InChIKey is YLYWAZFEEUMEOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23F5/c1-19(2,3)18-13(7-6-8-17(18)21(24,25)26)12-20(4,5)14-9-15(22)11-16(23)10-14/h6-11H,12H2,1-5H3.
What are the key properties of 1-[1-[2-tert-butyl-3-(trifluoromethyl)phenyl]-2-methylpropan-2-yl]-3,5-difluorobenzene?
1-[1-[2-tert-butyl-3-(trifluoromethyl)phenyl]-2-methylpropan-2-yl]-3,5-difluorobenzene has a molecular weight of 370.41 g/mol, XLogP of 6.80, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[2-tert-butyl-3-(trifluoromethyl)phenyl]-2-methylpropan-2-yl]-3,5-difluorobenzene is sourced from PubChem (CID 170290026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).