About N-[5,7-dimethyl-2-[(Z)-4-methylpent-2-en-2-yl]oct-7-enyl]oxetan-3-amine
N-[5,7-dimethyl-2-[(Z)-4-methylpent-2-en-2-yl]oct-7-enyl]oxetan-3-amine (PubChem CID 170291023) has the molecular formula C19H35NO
and a molecular weight of 293.50 g/mol. Its IUPAC name is N-[5,7-dimethyl-2-[(Z)-4-methylpent-2-en-2-yl]oct-7-enyl]oxetan-3-amine.
Molecular Properties
| Compound Name | N-[5,7-dimethyl-2-[(Z)-4-methylpent-2-en-2-yl]oct-7-enyl]oxetan-3-amine |
| PubChem CID | 170291023 |
| Molecular Formula | C19H35NO |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.27 |
| IUPAC Name | N-[5,7-dimethyl-2-[(Z)-4-methylpent-2-en-2-yl]oct-7-enyl]oxetan-3-amine |
| SMILES | C=C(C)CC(C)CCC(CNC1COC1)/C(C)=C\C(C)C |
| InChI | InChI=1S/C19H35NO/c1-14(2)9-16(5)7-8-18(17(6)10-15(3)4)11-20-19-12-21-13-19/h10,15-16,18-20H,1,7-9,11-13H2,2-6H3/b17-10- |
| InChIKey | UMHNICSDCDRDAB-YVLHZVERSA-N |
| XLogP | 4.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[5,7-dimethyl-2-[(Z)-4-methylpent-2-en-2-yl]oct-7-enyl]oxetan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5,7-dimethyl-2-[(Z)-4-methylpent-2-en-2-yl]oct-7-enyl]oxetan-3-amine?
The IUPAC name of N-[5,7-dimethyl-2-[(Z)-4-methylpent-2-en-2-yl]oct-7-enyl]oxetan-3-amine (CID 170291023) is N-[5,7-dimethyl-2-[(Z)-4-methylpent-2-en-2-yl]oct-7-enyl]oxetan-3-amine.
What is the SMILES notation for N-[5,7-dimethyl-2-[(Z)-4-methylpent-2-en-2-yl]oct-7-enyl]oxetan-3-amine?
The canonical SMILES for N-[5,7-dimethyl-2-[(Z)-4-methylpent-2-en-2-yl]oct-7-enyl]oxetan-3-amine is C=C(C)CC(C)CCC(CNC1COC1)/C(C)=C\C(C)C.
What is the InChIKey of N-[5,7-dimethyl-2-[(Z)-4-methylpent-2-en-2-yl]oct-7-enyl]oxetan-3-amine?
The InChIKey is UMHNICSDCDRDAB-YVLHZVERSA-N. The full InChI is InChI=1S/C19H35NO/c1-14(2)9-16(5)7-8-18(17(6)10-15(3)4)11-20-19-12-21-13-19/h10,15-16,18-20H,1,7-9,11-13H2,2-6H3/b17-10-.
What are the key properties of N-[5,7-dimethyl-2-[(Z)-4-methylpent-2-en-2-yl]oct-7-enyl]oxetan-3-amine?
N-[5,7-dimethyl-2-[(Z)-4-methylpent-2-en-2-yl]oct-7-enyl]oxetan-3-amine has a molecular weight of 293.50 g/mol, XLogP of 4.58, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5,7-dimethyl-2-[(Z)-4-methylpent-2-en-2-yl]oct-7-enyl]oxetan-3-amine is sourced from PubChem (CID 170291023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).