About 1-butyl-4-fluoro-2,4-dimethyl-1-(3-methylbutyl)cyclopentane
1-butyl-4-fluoro-2,4-dimethyl-1-(3-methylbutyl)cyclopentane (PubChem CID 170291148) has the molecular formula C16H31F
and a molecular weight of 242.42 g/mol. Its IUPAC name is 1-butyl-4-fluoro-2,4-dimethyl-1-(3-methylbutyl)cyclopentane.
Molecular Properties
| Compound Name | 1-butyl-4-fluoro-2,4-dimethyl-1-(3-methylbutyl)cyclopentane |
| PubChem CID | 170291148 |
| Molecular Formula | C16H31F |
| Molecular Weight | 242.42 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | 1-butyl-4-fluoro-2,4-dimethyl-1-(3-methylbutyl)cyclopentane |
| SMILES | CCCCC1(CCC(C)C)CC(C)(F)CC1C |
| InChI | InChI=1S/C16H31F/c1-6-7-9-16(10-8-13(2)3)12-15(5,17)11-14(16)4/h13-14H,6-12H2,1-5H3 |
| InChIKey | AHRAVBKYSBEDQX-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 242.42 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-butyl-4-fluoro-2,4-dimethyl-1-(3-methylbutyl)cyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4-fluoro-2,4-dimethyl-1-(3-methylbutyl)cyclopentane?
The IUPAC name of 1-butyl-4-fluoro-2,4-dimethyl-1-(3-methylbutyl)cyclopentane (CID 170291148) is 1-butyl-4-fluoro-2,4-dimethyl-1-(3-methylbutyl)cyclopentane.
What is the SMILES notation for 1-butyl-4-fluoro-2,4-dimethyl-1-(3-methylbutyl)cyclopentane?
The canonical SMILES for 1-butyl-4-fluoro-2,4-dimethyl-1-(3-methylbutyl)cyclopentane is CCCCC1(CCC(C)C)CC(C)(F)CC1C.
What is the InChIKey of 1-butyl-4-fluoro-2,4-dimethyl-1-(3-methylbutyl)cyclopentane?
The InChIKey is AHRAVBKYSBEDQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31F/c1-6-7-9-16(10-8-13(2)3)12-15(5,17)11-14(16)4/h13-14H,6-12H2,1-5H3.
What are the key properties of 1-butyl-4-fluoro-2,4-dimethyl-1-(3-methylbutyl)cyclopentane?
1-butyl-4-fluoro-2,4-dimethyl-1-(3-methylbutyl)cyclopentane has a molecular weight of 242.42 g/mol, XLogP of 5.76, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4-fluoro-2,4-dimethyl-1-(3-methylbutyl)cyclopentane is sourced from PubChem (CID 170291148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).