C66H63N — CID 170291329
5-tert-butyl-N-[2-[8-(3,5-ditert-butylphenyl)naphthalen-1-yl]cyclohexa-2,4-dien-1-yl]-N-(3-phenanthren-1-ylphenyl)-2-phenylaniline (PubChem CID 170291329) has the molecular formula C66H63N and a molecular weight of 870.24 g/mol. Its IUPAC name is 5-tert-butyl-N-[2-[8-(3,5-ditert-butylphenyl)naphthalen-1-yl]cyclohexa-2,4-dien-1-yl]-N-(3-phenanthren-1-ylphenyl)-2-phenylaniline.
| Compound Name | 5-tert-butyl-N-[2-[8-(3,5-ditert-butylphenyl)naphthalen-1-yl]cyclohexa-2,4-dien-1-yl]-N-(3-phenanthren-1-ylphenyl)-2-phenylaniline |
|---|---|
| PubChem CID | 170291329 |
| Molecular Formula | C66H63N |
| Molecular Weight | 870.24 g/mol |
| Exact Mass | 869.50 |
| IUPAC Name | 5-tert-butyl-N-[2-[8-(3,5-ditert-butylphenyl)naphthalen-1-yl]cyclohexa-2,4-dien-1-yl]-N-(3-phenanthren-1-ylphenyl)-2-phenylaniline |
| SMILES | CC(C)(C)c1cc(-c2cccc3cccc(C4=CC=CCC4N(c4cccc(-c5cccc6c5ccc5ccccc56)c4)c4cc(C(C)(C)C)ccc4-c4ccccc4)c23)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C66H63N/c1-64(2,3)49-36-38-55(44-21-11-10-12-22-44)62(43-49)67(52-27-17-26-47(41-52)54-30-20-32-57-53-28-14-13-23-45(53)35-37-58(54)57)61-34-16-15-29-59(61)60-33-19-25-46-24-18-31-56(63(46)60)48-39-50(65(4,5)6)42-51(40-48)66(7,8)9/h10-33,35-43,61H,34H2,1-9H3 |
| InChIKey | OFLNJDXBNVQBPD-UHFFFAOYSA-N |
| XLogP | 18.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.24 |
| LogP ≤ 5 | 18.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|