About 2-[(1S,2S,4E)-1-hydroxy-2-methylcyclooct-4-en-1-yl]acetonitrile
2-[(1S,2S,4E)-1-hydroxy-2-methylcyclooct-4-en-1-yl]acetonitrile (PubChem CID 170291488) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 2-[(1S,2S,4E)-1-hydroxy-2-methylcyclooct-4-en-1-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[(1S,2S,4E)-1-hydroxy-2-methylcyclooct-4-en-1-yl]acetonitrile |
| PubChem CID | 170291488 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 2-[(1S,2S,4E)-1-hydroxy-2-methylcyclooct-4-en-1-yl]acetonitrile |
| SMILES | C[C@H]1C/C=C\CCC[C@]1(O)CC#N |
| InChI | InChI=1S/C11H17NO/c1-10-6-4-2-3-5-7-11(10,13)8-9-12/h2,4,10,13H,3,5-8H2,1H3/b4-2-/t10-,11-/m0/s1 |
| InChIKey | HPMRVTBHGWSMKW-MTCWXPTMSA-N |
| XLogP | 2.40 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1S,2S,4E)-1-hydroxy-2-methylcyclooct-4-en-1-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,2S,4E)-1-hydroxy-2-methylcyclooct-4-en-1-yl]acetonitrile?
The IUPAC name of 2-[(1S,2S,4E)-1-hydroxy-2-methylcyclooct-4-en-1-yl]acetonitrile (CID 170291488) is 2-[(1S,2S,4E)-1-hydroxy-2-methylcyclooct-4-en-1-yl]acetonitrile.
What is the SMILES notation for 2-[(1S,2S,4E)-1-hydroxy-2-methylcyclooct-4-en-1-yl]acetonitrile?
The canonical SMILES for 2-[(1S,2S,4E)-1-hydroxy-2-methylcyclooct-4-en-1-yl]acetonitrile is C[C@H]1C/C=C\CCC[C@]1(O)CC#N.
What is the InChIKey of 2-[(1S,2S,4E)-1-hydroxy-2-methylcyclooct-4-en-1-yl]acetonitrile?
The InChIKey is HPMRVTBHGWSMKW-MTCWXPTMSA-N. The full InChI is InChI=1S/C11H17NO/c1-10-6-4-2-3-5-7-11(10,13)8-9-12/h2,4,10,13H,3,5-8H2,1H3/b4-2-/t10-,11-/m0/s1.
What are the key properties of 2-[(1S,2S,4E)-1-hydroxy-2-methylcyclooct-4-en-1-yl]acetonitrile?
2-[(1S,2S,4E)-1-hydroxy-2-methylcyclooct-4-en-1-yl]acetonitrile has a molecular weight of 179.26 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,2S,4E)-1-hydroxy-2-methylcyclooct-4-en-1-yl]acetonitrile is sourced from PubChem (CID 170291488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).