C8H16N2 — CID 170291674
5,6-diethyl-1,2,3,4-tetrahydropyrimidine (PubChem CID 170291674) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is 5,6-diethyl-1,2,3,4-tetrahydropyrimidine.
| Compound Name | 5,6-diethyl-1,2,3,4-tetrahydropyrimidine |
|---|---|
| PubChem CID | 170291674 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 5,6-diethyl-1,2,3,4-tetrahydropyrimidine |
| SMILES | CCC1=C(CC)NCNC1 |
| InChI | InChI=1S/C8H16N2/c1-3-7-5-9-6-10-8(7)4-2/h9-10H,3-6H2,1-2H3 |
| InChIKey | JUZQAEJGSIKNNJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |