C13H21N2O8P — CID 170291832
[(2R)-2-[(1R,2R)-2-(2,4-dioxopyrimidin-1-yl)-1,2-dimethoxyethyl]-2-methoxycyclopropyl]methylphosphonic acid (PubChem CID 170291832) has the molecular formula C13H21N2O8P and a molecular weight of 364.29 g/mol. Its IUPAC name is [(2R)-2-[(1R,2R)-2-(2,4-dioxopyrimidin-1-yl)-1,2-dimethoxyethyl]-2-methoxycyclopropyl]methylphosphonic acid.
| Compound Name | [(2R)-2-[(1R,2R)-2-(2,4-dioxopyrimidin-1-yl)-1,2-dimethoxyethyl]-2-methoxycyclopropyl]methylphosphonic acid |
|---|---|
| PubChem CID | 170291832 |
| Molecular Formula | C13H21N2O8P |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | [(2R)-2-[(1R,2R)-2-(2,4-dioxopyrimidin-1-yl)-1,2-dimethoxyethyl]-2-methoxycyclopropyl]methylphosphonic acid |
| SMILES | CO[C@H]([C@H](OC)[C@@]1(OC)CC1CP(=O)(O)O)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C13H21N2O8P/c1-21-10(13(23-3)6-8(13)7-24(18,19)20)11(22-2)15-5-4-9(16)14-12(15)17/h4-5,8,10-11H,6-7H2,1-3H3,(H,14,16,17)(H2,18,19,20)/t8?,10-,11+,13+/m0/s1 |
| InChIKey | BLQJDWJYUVIZHE-DUQDJFPFSA-N |
| XLogP | -0.72 |
| TPSA | 140.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|