About [4-[3,5-di(propan-2-yl)phenyl]phenyl]methyl-trimethyl-λ4-sulfane
[4-[3,5-di(propan-2-yl)phenyl]phenyl]methyl-trimethyl-λ4-sulfane (PubChem CID 170292816) has the molecular formula C22H32S
and a molecular weight of 328.57 g/mol. Its IUPAC name is [4-[3,5-di(propan-2-yl)phenyl]phenyl]methyl-trimethyl-λ4-sulfane.
Molecular Properties
| Compound Name | [4-[3,5-di(propan-2-yl)phenyl]phenyl]methyl-trimethyl-λ4-sulfane |
| PubChem CID | 170292816 |
| Molecular Formula | C22H32S |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | [4-[3,5-di(propan-2-yl)phenyl]phenyl]methyl-trimethyl-λ4-sulfane |
| SMILES | CC(C)c1cc(-c2ccc(CS(C)(C)C)cc2)cc(C(C)C)c1 |
| InChI | InChI=1S/C22H32S/c1-16(2)20-12-21(17(3)4)14-22(13-20)19-10-8-18(9-11-19)15-23(5,6)7/h8-14,16-17H,15H2,1-7H3 |
| InChIKey | FUZRPSQFDXNMHB-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze [4-[3,5-di(propan-2-yl)phenyl]phenyl]methyl-trimethyl-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3,5-di(propan-2-yl)phenyl]phenyl]methyl-trimethyl-λ4-sulfane?
The IUPAC name of [4-[3,5-di(propan-2-yl)phenyl]phenyl]methyl-trimethyl-λ4-sulfane (CID 170292816) is [4-[3,5-di(propan-2-yl)phenyl]phenyl]methyl-trimethyl-λ4-sulfane.
What is the SMILES notation for [4-[3,5-di(propan-2-yl)phenyl]phenyl]methyl-trimethyl-λ4-sulfane?
The canonical SMILES for [4-[3,5-di(propan-2-yl)phenyl]phenyl]methyl-trimethyl-λ4-sulfane is CC(C)c1cc(-c2ccc(CS(C)(C)C)cc2)cc(C(C)C)c1.
What is the InChIKey of [4-[3,5-di(propan-2-yl)phenyl]phenyl]methyl-trimethyl-λ4-sulfane?
The InChIKey is FUZRPSQFDXNMHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32S/c1-16(2)20-12-21(17(3)4)14-22(13-20)19-10-8-18(9-11-19)15-23(5,6)7/h8-14,16-17H,15H2,1-7H3.
What are the key properties of [4-[3,5-di(propan-2-yl)phenyl]phenyl]methyl-trimethyl-λ4-sulfane?
[4-[3,5-di(propan-2-yl)phenyl]phenyl]methyl-trimethyl-λ4-sulfane has a molecular weight of 328.57 g/mol, XLogP of 6.79, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3,5-di(propan-2-yl)phenyl]phenyl]methyl-trimethyl-λ4-sulfane is sourced from PubChem (CID 170292816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).