About (2S)-4-chloro-N,N-dimethyl-2-(methylamino)butanamide
(2S)-4-chloro-N,N-dimethyl-2-(methylamino)butanamide (PubChem CID 170293108) has the molecular formula C7H15ClN2O
and a molecular weight of 178.66 g/mol. Its IUPAC name is (2S)-4-chloro-N,N-dimethyl-2-(methylamino)butanamide.
Molecular Properties
| Compound Name | (2S)-4-chloro-N,N-dimethyl-2-(methylamino)butanamide |
| PubChem CID | 170293108 |
| Molecular Formula | C7H15ClN2O |
| Molecular Weight | 178.66 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | (2S)-4-chloro-N,N-dimethyl-2-(methylamino)butanamide |
| SMILES | CN[C@@H](CCCl)C(=O)N(C)C |
| InChI | InChI=1S/C7H15ClN2O/c1-9-6(4-5-8)7(11)10(2)3/h6,9H,4-5H2,1-3H3/t6-/m0/s1 |
| InChIKey | CYDJNGGVSIQJNH-LURJTMIESA-N |
| XLogP | 0.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.66 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S)-4-chloro-N,N-dimethyl-2-(methylamino)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-chloro-N,N-dimethyl-2-(methylamino)butanamide?
The IUPAC name of (2S)-4-chloro-N,N-dimethyl-2-(methylamino)butanamide (CID 170293108) is (2S)-4-chloro-N,N-dimethyl-2-(methylamino)butanamide.
What is the SMILES notation for (2S)-4-chloro-N,N-dimethyl-2-(methylamino)butanamide?
The canonical SMILES for (2S)-4-chloro-N,N-dimethyl-2-(methylamino)butanamide is CN[C@@H](CCCl)C(=O)N(C)C.
What is the InChIKey of (2S)-4-chloro-N,N-dimethyl-2-(methylamino)butanamide?
The InChIKey is CYDJNGGVSIQJNH-LURJTMIESA-N. The full InChI is InChI=1S/C7H15ClN2O/c1-9-6(4-5-8)7(11)10(2)3/h6,9H,4-5H2,1-3H3/t6-/m0/s1.
What are the key properties of (2S)-4-chloro-N,N-dimethyl-2-(methylamino)butanamide?
(2S)-4-chloro-N,N-dimethyl-2-(methylamino)butanamide has a molecular weight of 178.66 g/mol, XLogP of 0.29, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-chloro-N,N-dimethyl-2-(methylamino)butanamide is sourced from PubChem (CID 170293108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).