C30H37NS — CID 170293156
(4E,5Z,8Z)-2-buta-1,3-dien-2-ylsulfanyl-7-methylidene-4-[(Z)-2-methylidenepent-3-enylidene]-N-[(1Z,5Z)-4-methyl-3-methylidenehepta-1,5-dienyl]deca-1,5,8-trien-3-imine (PubChem CID 170293156) has the molecular formula C30H37NS and a molecular weight of 443.70 g/mol. Its IUPAC name is (4E,5Z,8Z)-2-buta-1,3-dien-2-ylsulfanyl-7-methylidene-4-[(Z)-2-methylidenepent-3-enylidene]-N-[(1Z,5Z)-4-methyl-3-methylidenehepta-1,5-dienyl]deca-1,5,8-trien-3-imine.
| Compound Name | (4E,5Z,8Z)-2-buta-1,3-dien-2-ylsulfanyl-7-methylidene-4-[(Z)-2-methylidenepent-3-enylidene]-N-[(1Z,5Z)-4-methyl-3-methylidenehepta-1,5-dienyl]deca-1,5,8-trien-3-imine |
|---|---|
| PubChem CID | 170293156 |
| Molecular Formula | C30H37NS |
| Molecular Weight | 443.70 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | (4E,5Z,8Z)-2-buta-1,3-dien-2-ylsulfanyl-7-methylidene-4-[(Z)-2-methylidenepent-3-enylidene]-N-[(1Z,5Z)-4-methyl-3-methylidenehepta-1,5-dienyl]deca-1,5,8-trien-3-imine |
| SMILES | C=CC(=C)SC(=C)C(=N\C=C/C(=C)C(C)/C=C\C)/C(/C=C\C(=C)/C=C\C)=C\C(=C)/C=C\C |
| InChI | InChI=1S/C30H37NS/c1-11-15-23(5)18-19-29(22-24(6)16-12-2)30(28(10)32-27(9)14-4)31-21-20-26(8)25(7)17-13-3/h11-22,25H,4-6,8-10H2,1-3,7H3/b15-11-,16-12-,17-13-,19-18-,21-20-,29-22+,31-30+ |
| InChIKey | QQSNUCDAKLTILM-XRSBVRINSA-N |
| XLogP | 9.40 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.70 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|