C10H14FN — CID 170294076
(5S,8R)-5-fluoro-8-methyl-2,3,5,6,7,8-hexahydroquinoline (PubChem CID 170294076) has the molecular formula C10H14FN and a molecular weight of 167.23 g/mol. Its IUPAC name is (5S,8R)-5-fluoro-8-methyl-2,3,5,6,7,8-hexahydroquinoline.
| Compound Name | (5S,8R)-5-fluoro-8-methyl-2,3,5,6,7,8-hexahydroquinoline |
|---|---|
| PubChem CID | 170294076 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | (5S,8R)-5-fluoro-8-methyl-2,3,5,6,7,8-hexahydroquinoline |
| SMILES | C[C@@H]1CC[C@H](F)C2=CCCN=C21 |
| InChI | InChI=1S/C10H14FN/c1-7-4-5-9(11)8-3-2-6-12-10(7)8/h3,7,9H,2,4-6H2,1H3/t7-,9+/m1/s1 |
| InChIKey | FKKCJLSIQRGALL-APPZFPTMSA-N |
| XLogP | 2.53 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |