C9H9F7 — CID 170294216
1,1,2,2,3,3,4-heptafluoro-4-methyl-5-propan-2-ylidenecyclopentane (PubChem CID 170294216) has the molecular formula C9H9F7 and a molecular weight of 250.16 g/mol. Its IUPAC name is 1,1,2,2,3,3,4-heptafluoro-4-methyl-5-propan-2-ylidenecyclopentane.
| Compound Name | 1,1,2,2,3,3,4-heptafluoro-4-methyl-5-propan-2-ylidenecyclopentane |
|---|---|
| PubChem CID | 170294216 |
| Molecular Formula | C9H9F7 |
| Molecular Weight | 250.16 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 1,1,2,2,3,3,4-heptafluoro-4-methyl-5-propan-2-ylidenecyclopentane |
| SMILES | CC(C)=C1C(C)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9H9F7/c1-4(2)5-6(3,10)8(13,14)9(15,16)7(5,11)12/h1-3H3 |
| InChIKey | JOYNAJKIROSOAC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.16 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|