C32H44N4O5S — CID 170297469
3-[[4-[(2R)-2-amino-4,4-dimethylpentoxy]-6-[(1E,3Z,5E)-2-(cyclopentylmethyl)hepta-1,3,5-trienyl]-5-methylpyrimidin-2-yl]sulfamoyl]benzoic acid (PubChem CID 170297469) has the molecular formula C32H44N4O5S and a molecular weight of 596.79 g/mol. Its IUPAC name is 3-[[4-[(2R)-2-amino-4,4-dimethylpentoxy]-6-[(1E,3Z,5E)-2-(cyclopentylmethyl)hepta-1,3,5-trienyl]-5-methylpyrimidin-2-yl]sulfamoyl]benzoic acid.
| Compound Name | 3-[[4-[(2R)-2-amino-4,4-dimethylpentoxy]-6-[(1E,3Z,5E)-2-(cyclopentylmethyl)hepta-1,3,5-trienyl]-5-methylpyrimidin-2-yl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 170297469 |
| Molecular Formula | C32H44N4O5S |
| Molecular Weight | 596.79 g/mol |
| Exact Mass | 596.30 |
| IUPAC Name | 3-[[4-[(2R)-2-amino-4,4-dimethylpentoxy]-6-[(1E,3Z,5E)-2-(cyclopentylmethyl)hepta-1,3,5-trienyl]-5-methylpyrimidin-2-yl]sulfamoyl]benzoic acid |
| SMILES | C/C=C/C=C\C(=C\c1nc(NS(=O)(=O)c2cccc(C(=O)O)c2)nc(OC[C@H](N)CC(C)(C)C)c1C)CC1CCCC1 |
| InChI | InChI=1S/C32H44N4O5S/c1-6-7-8-14-24(17-23-12-9-10-13-23)18-28-22(2)29(41-21-26(33)20-32(3,4)5)35-31(34-28)36-42(39,40)27-16-11-15-25(19-27)30(37)38/h6-8,11,14-16,18-19,23,26H,9-10,12-13,17,20-21,33H2,1-5H3,(H,37,38)(H,34,35,36)/b7-6+,14-8-,24-18-/t26-/m1/s1 |
| InChIKey | FOBSPIYLCZWNPR-SRWHFFGZSA-N |
| XLogP | 6.52 |
| TPSA | 144.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.79 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|