C25H23ClN4O2 — CID 17029838
2-chloro-N-[1-[1-[2-(3-methylanilino)-2-oxoethyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 17029838) has the molecular formula C25H23ClN4O2 and a molecular weight of 446.94 g/mol. Its IUPAC name is 2-chloro-N-[1-[1-[2-(3-methylanilino)-2-oxoethyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 2-chloro-N-[1-[1-[2-(3-methylanilino)-2-oxoethyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 17029838 |
| Molecular Formula | C25H23ClN4O2 |
| Molecular Weight | 446.94 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 2-chloro-N-[1-[1-[2-(3-methylanilino)-2-oxoethyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | Cc1cccc(NC(=O)Cn2c(C(C)NC(=O)c3ccccc3Cl)nc3ccccc32)c1 |
| InChI | InChI=1S/C25H23ClN4O2/c1-16-8-7-9-18(14-16)28-23(31)15-30-22-13-6-5-12-21(22)29-24(30)17(2)27-25(32)19-10-3-4-11-20(19)26/h3-14,17H,15H2,1-2H3,(H,27,32)(H,28,31) |
| InChIKey | QQIVDYKMOZFTJQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.94 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |