C41H46N6O3 — CID 170300130
3-[(4R)-4,7-dimethyl-1-oxo-10-[3-(3,4,5-trimethylphenoxy)propyl]-6-(1,3,5-trimethylpyrazol-4-yl)-3,4-dihydropyrazino[1,2-a]indol-2-yl]-1-methylindole-5-carboxamide (PubChem CID 170300130) has the molecular formula C41H46N6O3 and a molecular weight of 670.86 g/mol. Its IUPAC name is 3-[(4R)-4,7-dimethyl-1-oxo-10-[3-(3,4,5-trimethylphenoxy)propyl]-6-(1,3,5-trimethylpyrazol-4-yl)-3,4-dihydropyrazino[1,2-a]indol-2-yl]-1-methylindole-5-carboxamide.
| Compound Name | 3-[(4R)-4,7-dimethyl-1-oxo-10-[3-(3,4,5-trimethylphenoxy)propyl]-6-(1,3,5-trimethylpyrazol-4-yl)-3,4-dihydropyrazino[1,2-a]indol-2-yl]-1-methylindole-5-carboxamide |
|---|---|
| PubChem CID | 170300130 |
| Molecular Formula | C41H46N6O3 |
| Molecular Weight | 670.86 g/mol |
| Exact Mass | 670.36 |
| IUPAC Name | 3-[(4R)-4,7-dimethyl-1-oxo-10-[3-(3,4,5-trimethylphenoxy)propyl]-6-(1,3,5-trimethylpyrazol-4-yl)-3,4-dihydropyrazino[1,2-a]indol-2-yl]-1-methylindole-5-carboxamide |
| SMILES | Cc1cc(OCCCc2c3n(c4c(-c5c(C)nn(C)c5C)c(C)ccc24)[C@H](C)CN(c2cn(C)c4ccc(C(N)=O)cc24)C3=O)cc(C)c1C |
| InChI | InChI=1S/C41H46N6O3/c1-22-12-14-32-31(11-10-16-50-30-17-23(2)26(5)24(3)18-30)39-41(49)46(35-21-44(8)34-15-13-29(40(42)48)19-33(34)35)20-25(4)47(39)38(32)36(22)37-27(6)43-45(9)28(37)7/h12-15,17-19,21,25H,10-11,16,20H2,1-9H3,(H2,42,48)/t25-/m1/s1 |
| InChIKey | IRYBJYNGGVOGEW-RUZDIDTESA-N |
| XLogP | 7.72 |
| TPSA | 100.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.86 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|