C30H29F4N5O3S — CID 170300139
(2S,4R)-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-difluorofluorene-2-carbonyl)amino]-3-oxopropyl]-4-fluoro-4-(fluoromethyl)pyrrolidine-2-carboxamide (PubChem CID 170300139) has the molecular formula C30H29F4N5O3S and a molecular weight of 615.65 g/mol. Its IUPAC name is (2S,4R)-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-difluorofluorene-2-carbonyl)amino]-3-oxopropyl]-4-fluoro-4-(fluoromethyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-difluorofluorene-2-carbonyl)amino]-3-oxopropyl]-4-fluoro-4-(fluoromethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 170300139 |
| Molecular Formula | C30H29F4N5O3S |
| Molecular Weight | 615.65 g/mol |
| Exact Mass | 615.19 |
| IUPAC Name | (2S,4R)-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-1-[2-[(9,9-difluorofluorene-2-carbonyl)amino]-3-oxopropyl]-4-fluoro-4-(fluoromethyl)pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1csc([C@@H](C)NC(=O)[C@@H]2C[C@](F)(CF)CN2CC(C=O)NC(=O)c2ccc3c(c2)C(F)(F)c2ccccc2-3)c1 |
| InChI | InChI=1S/C30H29F4N5O3S/c1-16(25-9-18(13-43-25)26(35)36)37-28(42)24-10-29(32,14-31)15-39(24)11-19(12-40)38-27(41)17-6-7-21-20-4-2-3-5-22(20)30(33,34)23(21)8-17/h2-9,12-13,16,19,24H,10-11,14-15H2,1H3,(H3,35,36)(H,37,42)(H,38,41)/t16-,19?,24+,29+/m1/s1 |
| InChIKey | NYPZAICJSFACPC-ULRVBPQXSA-N |
| XLogP | 4.08 |
| TPSA | 128.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.65 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|