About (1S,2R)-2-fluoro-1,3-dimethyl-9-azabicyclo[3.3.1]nonane
(1S,2R)-2-fluoro-1,3-dimethyl-9-azabicyclo[3.3.1]nonane (PubChem CID 170300772) has the molecular formula C10H18FN
and a molecular weight of 171.26 g/mol. Its IUPAC name is (1S,2R)-2-fluoro-1,3-dimethyl-9-azabicyclo[3.3.1]nonane.
Molecular Properties
| Compound Name | (1S,2R)-2-fluoro-1,3-dimethyl-9-azabicyclo[3.3.1]nonane |
| PubChem CID | 170300772 |
| Molecular Formula | C10H18FN |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | (1S,2R)-2-fluoro-1,3-dimethyl-9-azabicyclo[3.3.1]nonane |
| SMILES | CC1CC2CCC[C@](C)(N2)[C@@H]1F |
| InChI | InChI=1S/C10H18FN/c1-7-6-8-4-3-5-10(2,12-8)9(7)11/h7-9,12H,3-6H2,1-2H3/t7?,8?,9-,10+/m1/s1 |
| InChIKey | ZGDASMVAPWENGK-BMNUFHGDSA-N |
| XLogP | 2.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S,2R)-2-fluoro-1,3-dimethyl-9-azabicyclo[3.3.1]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2R)-2-fluoro-1,3-dimethyl-9-azabicyclo[3.3.1]nonane?
The IUPAC name of (1S,2R)-2-fluoro-1,3-dimethyl-9-azabicyclo[3.3.1]nonane (CID 170300772) is (1S,2R)-2-fluoro-1,3-dimethyl-9-azabicyclo[3.3.1]nonane.
What is the SMILES notation for (1S,2R)-2-fluoro-1,3-dimethyl-9-azabicyclo[3.3.1]nonane?
The canonical SMILES for (1S,2R)-2-fluoro-1,3-dimethyl-9-azabicyclo[3.3.1]nonane is CC1CC2CCC[C@](C)(N2)[C@@H]1F.
What is the InChIKey of (1S,2R)-2-fluoro-1,3-dimethyl-9-azabicyclo[3.3.1]nonane?
The InChIKey is ZGDASMVAPWENGK-BMNUFHGDSA-N. The full InChI is InChI=1S/C10H18FN/c1-7-6-8-4-3-5-10(2,12-8)9(7)11/h7-9,12H,3-6H2,1-2H3/t7?,8?,9-,10+/m1/s1.
What are the key properties of (1S,2R)-2-fluoro-1,3-dimethyl-9-azabicyclo[3.3.1]nonane?
(1S,2R)-2-fluoro-1,3-dimethyl-9-azabicyclo[3.3.1]nonane has a molecular weight of 171.26 g/mol, XLogP of 2.27, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2R)-2-fluoro-1,3-dimethyl-9-azabicyclo[3.3.1]nonane is sourced from PubChem (CID 170300772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).