C46H29NO2 — CID 170301401
N-dibenzofuran-1-yl-5-phenyl-N-(4-phenylphenyl)naphtho[2,1-b][1]benzofuran-10-amine (PubChem CID 170301401) has the molecular formula C46H29NO2 and a molecular weight of 627.70 g/mol. Its IUPAC name is N-dibenzofuran-1-yl-5-phenyl-N-(4-phenylphenyl)naphtho[2,1-b][1]benzofuran-10-amine.
| Compound Name | N-dibenzofuran-1-yl-5-phenyl-N-(4-phenylphenyl)naphtho[2,1-b][1]benzofuran-10-amine |
|---|---|
| PubChem CID | 170301401 |
| Molecular Formula | C46H29NO2 |
| Molecular Weight | 627.70 g/mol |
| Exact Mass | 627.22 |
| IUPAC Name | N-dibenzofuran-1-yl-5-phenyl-N-(4-phenylphenyl)naphtho[2,1-b][1]benzofuran-10-amine |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)N(C3=CC4=C(C=C3)OC5=C4C6=CC=CC=C6C(=C5)C7=CC=CC=C7)C8=C9C1=CC=CC=C1OC9=CC=C8 |
| InChI | InChI=1S/C46H29NO2/c1-3-12-30(13-4-1)31-22-24-33(25-23-31)47(40-19-11-21-43-46(40)37-18-9-10-20-41(37)48-43)34-26-27-42-39(28-34)45-36-17-8-7-16-35(36)38(29-44(45)49-42)32-14-5-2-6-15-32/h1-29H |
| InChIKey | SOGJGOHENQTNHO-UHFFFAOYSA-N |
| XLogP | 13.10 |
| TPSA | 29.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | 1090 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.70 |
| LogP ≤ 5 | 13.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |