C29H37N5O2 — CID 170302174
1-[6-[5-amino-6-(3-piperidin-1-ylpropoxy)-3-pyridinyl]-3-(dimethylamino)quinolin-4-yl]cyclobutane-1-carbaldehyde (PubChem CID 170302174) has the molecular formula C29H37N5O2 and a molecular weight of 487.65 g/mol. Its IUPAC name is 1-[6-[5-amino-6-(3-piperidin-1-ylpropoxy)-3-pyridinyl]-3-(dimethylamino)quinolin-4-yl]cyclobutane-1-carbaldehyde.
| Compound Name | 1-[6-[5-amino-6-(3-piperidin-1-ylpropoxy)-3-pyridinyl]-3-(dimethylamino)quinolin-4-yl]cyclobutane-1-carbaldehyde |
|---|---|
| PubChem CID | 170302174 |
| Molecular Formula | C29H37N5O2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | 1-[6-[5-amino-6-(3-piperidin-1-ylpropoxy)-3-pyridinyl]-3-(dimethylamino)quinolin-4-yl]cyclobutane-1-carbaldehyde |
| SMILES | CN(C)c1cnc2ccc(-c3cnc(OCCCN4CCCCC4)c(N)c3)cc2c1C1(C=O)CCC1 |
| InChI | InChI=1S/C29H37N5O2/c1-33(2)26-19-31-25-9-8-21(16-23(25)27(26)29(20-35)10-6-11-29)22-17-24(30)28(32-18-22)36-15-7-14-34-12-4-3-5-13-34/h8-9,16-20H,3-7,10-15,30H2,1-2H3 |
| InChIKey | YOAOYLHAXQFBKO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|