C34H35Cl4N5 — CID 170302183
(2E)-2-[(Z)-but-2-enylidene]-N,1-bis(3,4-dichlorophenyl)-3-methylidene-7-(2,2,6,6-tetramethylpiperidin-4-yl)iminoquinoxalin-6-amine (PubChem CID 170302183) has the molecular formula C34H35Cl4N5 and a molecular weight of 655.50 g/mol. Its IUPAC name is (2E)-2-[(Z)-but-2-enylidene]-N,1-bis(3,4-dichlorophenyl)-3-methylidene-7-(2,2,6,6-tetramethylpiperidin-4-yl)iminoquinoxalin-6-amine.
| Compound Name | (2E)-2-[(Z)-but-2-enylidene]-N,1-bis(3,4-dichlorophenyl)-3-methylidene-7-(2,2,6,6-tetramethylpiperidin-4-yl)iminoquinoxalin-6-amine |
|---|---|
| PubChem CID | 170302183 |
| Molecular Formula | C34H35Cl4N5 |
| Molecular Weight | 655.50 g/mol |
| Exact Mass | 653.16 |
| IUPAC Name | (2E)-2-[(Z)-but-2-enylidene]-N,1-bis(3,4-dichlorophenyl)-3-methylidene-7-(2,2,6,6-tetramethylpiperidin-4-yl)iminoquinoxalin-6-amine |
| SMILES | C=c1nc2cc(Nc3ccc(Cl)c(Cl)c3)/c(=N/C3CC(C)(C)NC(C)(C)C3)cc-2n(-c2ccc(Cl)c(Cl)c2)/c1=C/C=C\C |
| InChI | InChI=1S/C34H35Cl4N5/c1-7-8-9-31-20(2)39-30-16-28(40-21-10-12-24(35)26(37)14-21)29(41-22-18-33(3,4)42-34(5,6)19-22)17-32(30)43(31)23-11-13-25(36)27(38)15-23/h7-17,22,40,42H,2,18-19H2,1,3-6H3/b8-7-,31-9+,41-29+ |
| InChIKey | WPHCOEKEYNACPK-UTVXQPSMSA-N |
| XLogP | 8.31 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.50 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |